| CAS-Nummer | 74863-82-4 |
|---|
| Summenformel | C10H8ClNO2S |
|---|
| Molare Masse | 241.69 g/mol |
|---|
| Aussehen | White to pale brown solid |
|---|
| Schmelzpunkt | 158-159 °C |
|---|
| SMILES | Cc1cnc2c(S(=O)(=O)Cl)cccc2c1 |
|---|
| InChIKey | XCMAYGDQKTWICK-UHFFFAOYSA-N |
|---|
| Beschreibung | 3-Methyl-8-quinolinesulfonyl chloride, a quinoline derivative with methyl and sulfonyl chloride. The sulfonyl chloride forms sulfonamide bonds for quinoline sulfonamide drugs. |
|---|
| Anwendungen | Pharmaceutical intermediate; quinoline; sulfonylating agent |
|---|
| Gefahrenklasse | Skin Corr. 1B; Eye Dam. 1 |
|---|
| Gefahrenhinweise (H-Sätze) | H314; H318 |
|---|
| Sicherheitshinweise (P-Sätze) | P260; P264; P280; P301+P330+P331; P303+P361+P353; P304+P340+P310; P305+P351+P338+P310; P321; P363; P390; P405; P406; P501 |
|---|
