| CAS Number | 203787-91-1 |
| Molecular Formula | C15H20NNaO4 |
| Molecular Weight | 301.31 g/mol |
| Appearance | White to off-white solid |
| Melting Point | 183-185 °C |
| SMILES | O=C([O-])CCCCCCCNC(=O)c1ccccc1O.[Na+] |
| InChIKey | UOENJXXSKABLJL-UHFFFAOYSA-M |
| Description | Sodium 8-(2-hydroxybenzamido)octanoate, a salicylamide derivative sodium salt. Possesses anti-inflammatory and immunomodulatory activity. |
| Applications | API; anti-inflammatory |
| Hazard Class | Acute Tox. 4 (Oral); Skin Irrit. 2; Eye Irrit. 2; STOT SE 3 (Resp) |
| Hazard Statements | H302; H315; H319; H335 |
| Precautionary Statements | P261; P264; P270; P271; P280; P301+P312; P302+P352; P304+P340; P305+P351+P338; P312; P321; P330; P332+P313; P337+P313; P362; P403+P233; P405; P501 |