| Numéro CAS | 1255309-13-7 |
|---|
| Formule moléculaire | C18H20BNO2 |
|---|
| Masse molaire | 293.20 g/mol |
|---|
| Aspect | Off-white to light yellow crystalline powder |
|---|
| Point de fusion | 177 °C |
|---|
| SMILES | CC1(C)OB(c2cccc3[nH]c4ccccc4c23)OC1(C)C |
|---|
| InChIKey | BLFDNIPIBSFUEL-UHFFFAOYSA-N |
|---|
| Description | Carbazole-4-boronic acid pinacol ester, an N-unprotected carbazole boronate. The boronate is a Suzuki coupling handle; the carbazole NH allows further functionalization for hole transport materials. |
|---|
| Applications | OLED hole transport material synthesis; Suzuki coupling substrate |
|---|
