| CAS-Nummer | 1403766-90-4 |
|---|---|
| Summenformel | C9H13FO4 |
| Molare Masse | 204.20 g/mol |
| Aussehen | Colourless liquid |
| SMILES | CC(C)OC(=O)C1(C(=O)O)CC(F)C1 |
| InChIKey | MAEAPDROKKEFAQ-UHFFFAOYSA-N |
| Beschreibung | Fluorinated cyclobutane dicarboxylate building block with isopropyl ester and free acid for selective deprotection. The fluorine modulates metabolic stability for drug-like cyclobutane scaffolds. |
| Anwendungen | Pharmaceutical intermediate; fluorinated building block; cyclobutane scaffold construction |
| Geschätzter Siedepunkt | 293.7 °C (vorhergesagt) |
|---|---|
| Geschätzte Dichte | 1.24 g/cm³ (vorhergesagt) |