| CAS 번호 | 1403766-90-4 |
|---|---|
| 분자식 | C9H13FO4 |
| 분자량 | 204.20 g/mol |
| 외관 | Colourless liquid |
| SMILES | CC(C)OC(=O)C1(C(=O)O)CC(F)C1 |
| InChIKey | MAEAPDROKKEFAQ-UHFFFAOYSA-N |
| 제품 설명 | Fluorinated cyclobutane dicarboxylate building block with isopropyl ester and free acid for selective deprotection. The fluorine modulates metabolic stability for drug-like cyclobutane scaffolds. |
| 용도 | Pharmaceutical intermediate; fluorinated building block; cyclobutane scaffold construction |
| 예상 끓는점 | 293.7 °C (예측값) |
|---|---|
| 예상 밀도 | 1.24 g/cm³ (예측값) |
