| CAS-Nummer | 1158758-79-2 |
| EC-/Listennummer | 894-091-1 |
| Summenformel | C10H20N2O2 |
| Molare Masse | 200.28 g/mol |
| Aussehen | Light yellow liquid |
| SMILES | CCC1(N)CN(C(=O)OC(C)(C)C)C1 |
| InChIKey | JPYCVKPRVHXSNZ-UHFFFAOYSA-N |
| Beschreibung | tert-Butyl 3-amino-3-ethylazetidine-1-carboxylate, a Boc-protected 3-amino-3-ethylazetidine. The 3,3-disubstitution provides a quaternary center and scaffold rigidity. |
| Anwendungen | Pharmaceutical intermediate; azetidine; Boc-protected |
| Gefahrenklasse | Skin Irrit. 2; Eye Irrit. 2; STOT SE 3 (Resp) |
| Gefahrenhinweise (H-Sätze) | H315; H319; H335 |
| Sicherheitshinweise (P-Sätze) | P261; P264; P271; P280; P302+P352; P304+P340; P305+P351+P338; P312; P321; P332+P313; P337+P313; P362; P403+P233; P405; P501 |