| CAS 번호 | 1158758-79-2 |
|---|
| EC/List 번호 | 894-091-1 |
|---|
| 분자식 | C10H20N2O2 |
|---|
| 분자량 | 200.28 g/mol |
|---|
| 외관 | Light yellow liquid |
|---|
| SMILES | CCC1(N)CN(C(=O)OC(C)(C)C)C1 |
|---|
| InChIKey | JPYCVKPRVHXSNZ-UHFFFAOYSA-N |
|---|
| 제품 설명 | tert-Butyl 3-amino-3-ethylazetidine-1-carboxylate, a Boc-protected 3-amino-3-ethylazetidine. The 3,3-disubstitution provides a quaternary center and scaffold rigidity. |
|---|
| 용도 | Pharmaceutical intermediate; azetidine; Boc-protected |
|---|
| 위험물 등급 | Skin Irrit. 2; Eye Irrit. 2; STOT SE 3 (Resp) |
|---|
| 유해·위험 문구 | H315; H319; H335 |
|---|
| 예방조치 문구 | P261; P264; P271; P280; P302+P352; P304+P340; P305+P351+P338; P312; P321; P332+P313; P337+P313; P362; P403+P233; P405; P501 |
|---|
