| CAS-Nummer | 69-89-6 |
|---|
| EC-/Listennummer | 200-718-6 |
|---|
| Summenformel | C5H4N4O2 |
|---|
| Molare Masse | 152.11 g/mol |
|---|
| Schmelzpunkt | >300 °C (dec.) |
|---|
| Siedepunkt | Sublimes (dec.) |
|---|
| Brechungsindex | 1.8500 (estimate) |
|---|
| SMILES | O=c1[nH]c(=O)c2[nH]cnc2[nH]1 |
|---|
| InChIKey | LRFVTYWOQMYALW-UHFFFAOYSA-N |
|---|
| Beschreibung | Xanthine (3,7-dihydropurine-2,6-dione), the purine alkaloid parent core. The parent compound of caffeine, theophylline, and theobromine; an important bioactive scaffold. |
|---|
| Anwendungen | Pharmaceutical intermediate; purine scaffold; alkaloid |
|---|
| Gefahrenklasse | Skin Sens. 1; Eye Irrit. 2 |
|---|
| Gefahrenhinweise (H-Sätze) | H317; H319 |
|---|
| Sicherheitshinweise (P-Sätze) | P261; P264; P272; P280; P302+P352; P305+P351+P338; P321; P333+P313; P337+P313; P362+P364; P501 |
|---|
