| CAS 번호 | 69-89-6 |
|---|
| EC/List 번호 | 200-718-6 |
|---|
| 분자식 | C5H4N4O2 |
|---|
| 분자량 | 152.11 g/mol |
|---|
| 녹는점 | >300 °C (dec.) |
|---|
| 끓는점 | Sublimes (dec.) |
|---|
| 굴절률 | 1.8500 (estimate) |
|---|
| SMILES | O=c1[nH]c(=O)c2[nH]cnc2[nH]1 |
|---|
| InChIKey | LRFVTYWOQMYALW-UHFFFAOYSA-N |
|---|
| 제품 설명 | Xanthine (3,7-dihydropurine-2,6-dione), the purine alkaloid parent core. The parent compound of caffeine, theophylline, and theobromine; an important bioactive scaffold. |
|---|
| 용도 | Pharmaceutical intermediate; purine scaffold; alkaloid |
|---|
| 위험물 등급 | Skin Sens. 1; Eye Irrit. 2 |
|---|
| 유해·위험 문구 | H317; H319 |
|---|
| 예방조치 문구 | P261; P264; P272; P280; P302+P352; P305+P351+P338; P321; P333+P313; P337+P313; P362+P364; P501 |
|---|
