| CAS-Nummer | 2253847-57-1 |
|---|---|
| Summenformel | C18H12N2O2 |
| Molare Masse | 288.30 g/mol |
| Aussehen | Yellow to yellow-green solid |
| SMILES | O=[N+]([O-])c1ccccc1-c1cccc2[nH]c3ccccc3c12 |
| InChIKey | KIGLUVGGXJPXKC-UHFFFAOYSA-N |
| Beschreibung | 4-(2-Nitrophenyl)-9H-carbazole, an ortho-nitro substituted carbazole. The nitro group can be reduced to amine for constructing carbazole-arylamine OLED hole transport materials. |
| Anwendungen | OLED hole transport material synthesis; carbazole functionalization |
| Geschätzter Siedepunkt | 529.4 °C (vorhergesagt) |
|---|---|
| Geschätzte Dichte | 1.352 g/cm³ (vorhergesagt) |