| CAS Number | 2253847-57-1 |
|---|---|
| Molecular Formula | C18H12N2O2 |
| Molecular Weight | 288.30 g/mol |
| Appearance | Yellow to yellow-green solid |
| SMILES | O=[N+]([O-])c1ccccc1-c1cccc2[nH]c3ccccc3c12 |
| InChIKey | KIGLUVGGXJPXKC-UHFFFAOYSA-N |
| Description | 4-(2-Nitrophenyl)-9H-carbazole, an ortho-nitro substituted carbazole. The nitro group can be reduced to amine for constructing carbazole-arylamine OLED hole transport materials. |
| Applications | OLED hole transport material synthesis; carbazole functionalization |
| Estimated Boiling Point | 529.4 °C (predicted) |
|---|---|
| Estimated Density | 1.352 g/cm³ (predicted) |