| CAS-Nummer | 288071-87-4 |
|---|
| EC-/Listennummer | 683-683-3 |
|---|
| Summenformel | C14H6Br2N2S3 |
|---|
| Molare Masse | 458.20 g/mol |
|---|
| Schmelzpunkt | 245-249 °C |
|---|
| SMILES | Brc1ccc(-c2ccc(-c3ccc(Br)s3)c3nsnc23)s1 |
|---|
| InChIKey | ZIIMIGRZSUYQGW-UHFFFAOYSA-N |
|---|
| Beschreibung | 4,7-Bis(2-bromo-5-thienyl)-2,1,3-benzothiadiazole, a benzothiadiazole with two bromothienyl groups. Important monomer for narrow-bandgap polymer solar cells and OLED materials. |
|---|
| Anwendungen | OLED intermediate; polymer solar cell; Stille coupling substrate |
|---|
| Gefahrenklasse | Skin Irrit. 2; Eye Irrit. 2; STOT SE 3 (Resp) |
|---|
| Gefahrenhinweise (H-Sätze) | H315; H319; H335 |
|---|
| Sicherheitshinweise (P-Sätze) | P261; P264; P271; P280; P302+P352; P304+P340; P305+P351+P338; P312; P321; P332+P313; P337+P313; P362; P403+P233; P405; P501 |
|---|
