| CAS 번호 | 288071-87-4 |
|---|
| EC/List 번호 | 683-683-3 |
|---|
| 분자식 | C14H6Br2N2S3 |
|---|
| 분자량 | 458.20 g/mol |
|---|
| 녹는점 | 245-249 °C |
|---|
| SMILES | Brc1ccc(-c2ccc(-c3ccc(Br)s3)c3nsnc23)s1 |
|---|
| InChIKey | ZIIMIGRZSUYQGW-UHFFFAOYSA-N |
|---|
| 제품 설명 | 4,7-Bis(2-bromo-5-thienyl)-2,1,3-benzothiadiazole, a benzothiadiazole with two bromothienyl groups. Important monomer for narrow-bandgap polymer solar cells and OLED materials. |
|---|
| 용도 | OLED intermediate; polymer solar cell; Stille coupling substrate |
|---|
| 위험물 등급 | Skin Irrit. 2; Eye Irrit. 2; STOT SE 3 (Resp) |
|---|
| 유해·위험 문구 | H315; H319; H335 |
|---|
| 예방조치 문구 | P261; P264; P271; P280; P302+P352; P304+P340; P305+P351+P338; P312; P321; P332+P313; P337+P313; P362; P403+P233; P405; P501 |
|---|
