| CAS 번호 | 791-31-1 |
|---|
| EC/List 번호 | 212-339-3 |
|---|
| 분자식 | C18H16OSi |
|---|
| 분자량 | 276.40 g/mol |
|---|
| 녹는점 | 150-153 °C (lit.) |
|---|
| 끓는점 | 389 °C (760 mmHg) |
|---|
| 밀도 | 1.13 g/cm³ |
|---|
| 굴절률 | 1.628 |
|---|
| SMILES | O[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
|---|
| InChIKey | NLSXASIDNWDYMI-UHFFFAOYSA-N |
|---|
| 제품 설명 | Triphenylsilanol, an organosilanol with three phenyl groups. Used as a hydroxylation reagent and silyl protecting group precursor in organic synthesis. |
|---|
| 용도 | Pharmaceutical intermediate; organosilicon; synthetic reagent |
|---|
| 위험물 등급 | Skin Irrit. 2; Eye Irrit. 2; STOT SE 3 (Resp) |
|---|
| 유해·위험 문구 | H315; H319; H335 |
|---|
| 예방조치 문구 | P261; P264; P271; P280; P302+P352; P304+P340; P305+P351+P338; P312; P321; P332+P313; P337+P313; P362; P403+P233; P405; P501 |
|---|
