| Номер CAS | 791-31-1 |
|---|
| Номер EC/List | 212-339-3 |
|---|
| Молекулярная формула | C18H16OSi |
|---|
| Молекулярная масса | 276.40 g/mol |
|---|
| Температура плавления | 150-153 °C (lit.) |
|---|
| Температура кипения | 389 °C (760 mmHg) |
|---|
| Плотность | 1.13 g/cm³ |
|---|
| Показатель преломления | 1.628 |
|---|
| SMILES | O[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
|---|
| InChIKey | NLSXASIDNWDYMI-UHFFFAOYSA-N |
|---|
| Описание | Triphenylsilanol, an organosilanol with three phenyl groups. Used as a hydroxylation reagent and silyl protecting group precursor in organic synthesis. |
|---|
| Применение | Pharmaceutical intermediate; organosilicon; synthetic reagent |
|---|
| Класс опасности | Skin Irrit. 2; Eye Irrit. 2; STOT SE 3 (Resp) |
|---|
| Коды опасности (H-фразы) | H315; H319; H335 |
|---|
| Меры предосторожности (P-фразы) | P261; P264; P271; P280; P302+P352; P304+P340; P305+P351+P338; P312; P321; P332+P313; P337+P313; P362; P403+P233; P405; P501 |
|---|
