| CAS 번호 | 619-14-7 |
|---|
| 분자식 | C7H5NO5 |
|---|
| 분자량 | 183.12 g/mol |
|---|
| 녹는점 | 229-231 °C (lit.) |
|---|
| 굴절률 | 1.6280 (estimate) |
|---|
| SMILES | O=C(O)c1ccc([N+](=O)[O-])c(O)c1 |
|---|
| InChIKey | XLDLRRGZWIEEHT-UHFFFAOYSA-N |
|---|
| 제품 설명 | 3-Hydroxy-4-nitrobenzoic acid, a disubstituted benzoic acid with hydroxyl and nitro. The nitro can be reduced to amine for aminohydroxybenzoic acid intermediates. |
|---|
| 용도 | Pharmaceutical intermediate; benzoic acid; nitrophenol |
|---|
| 위험물 등급 | Skin Irrit. 2; Eye Irrit. 2; STOT SE 3 (Resp) |
|---|
| 유해·위험 문구 | H315; H319; H335 |
|---|
| 예방조치 문구 | P261; P264; P271; P280; P302+P352; P304+P340; P305+P351+P338; P312; P321; P332+P313; P337+P313; P362; P403+P233; P405; P501 |
|---|
