| Номер CAS | 619-14-7 |
| Молекулярная формула | C7H5NO5 |
| Молекулярная масса | 183.12 g/mol |
| Температура плавления | 229-231 °C (lit.) |
| Показатель преломления | 1.6280 (estimate) |
| SMILES | O=C(O)c1ccc([N+](=O)[O-])c(O)c1 |
| InChIKey | XLDLRRGZWIEEHT-UHFFFAOYSA-N |
| Описание | 3-Hydroxy-4-nitrobenzoic acid, a disubstituted benzoic acid with hydroxyl and nitro. The nitro can be reduced to amine for aminohydroxybenzoic acid intermediates. |
| Применение | Pharmaceutical intermediate; benzoic acid; nitrophenol |
| Класс опасности | Skin Irrit. 2; Eye Irrit. 2; STOT SE 3 (Resp) |
| Коды опасности (H-фразы) | H315; H319; H335 |
| Меры предосторожности (P-фразы) | P261; P264; P271; P280; P302+P352; P304+P340; P305+P351+P338; P312; P321; P332+P313; P337+P313; P362; P403+P233; P405; P501 |