| CAS 번호 | 196212-27-8 |
|---|
| EC/List 번호 | 691-533-3 |
|---|
| 분자식 | C18H28B2O4 |
|---|
| 분자량 | 330.00 g/mol |
|---|
| 외관 | White powder |
|---|
| 녹는점 | 133.0 to 137.0 °C |
|---|
| SMILES | CC1(C)OB(c2cccc(B3OC(C)(C)C(C)(C)O3)c2)OC1(C)C |
|---|
| InChIKey | LLQQCDJVSYEQQQ-UHFFFAOYSA-N |
|---|
| 제품 설명 | 1,3-Benzenediboronic acid bis(pinacol) ester, a bifunctional Suzuki coupling substrate. Reacts with two aryl halides to construct 1,3-phenylene-bridged structures for OLED and polymer synthesis. |
|---|
| 용도 | Bifunctional Suzuki coupling substrate; OLED material synthesis; polymer crosslinker |
|---|
| 위험물 등급 | Skin Irrit. 2; Eye Irrit. 2; STOT SE 3 (Resp) |
|---|
| 유해·위험 문구 | H315; H319; H335 |
|---|
| 예방조치 문구 | P261; P264; P271; P280; P302+P352; P304+P340; P305+P351+P338; P312; P321; P332+P313; P337+P313; P362; P403+P233; P405; P501 |
|---|
