| Номер CAS | 196212-27-8 |
| Номер EC/List | 691-533-3 |
| Молекулярная формула | C18H28B2O4 |
| Молекулярная масса | 330.00 g/mol |
| Внешний вид | White powder |
| Температура плавления | 133.0 to 137.0 °C |
| SMILES | CC1(C)OB(c2cccc(B3OC(C)(C)C(C)(C)O3)c2)OC1(C)C |
| InChIKey | LLQQCDJVSYEQQQ-UHFFFAOYSA-N |
| Описание | 1,3-Benzenediboronic acid bis(pinacol) ester, a bifunctional Suzuki coupling substrate. Reacts with two aryl halides to construct 1,3-phenylene-bridged structures for OLED and polymer synthesis. |
| Применение | Bifunctional Suzuki coupling substrate; OLED material synthesis; polymer crosslinker |
| Класс опасности | Skin Irrit. 2; Eye Irrit. 2; STOT SE 3 (Resp) |
| Коды опасности (H-фразы) | H315; H319; H335 |
| Меры предосторожности (P-фразы) | P261; P264; P271; P280; P302+P352; P304+P340; P305+P351+P338; P312; P321; P332+P313; P337+P313; P362; P403+P233; P405; P501 |