| CAS Number | 74863-84-6 |
|---|---|
| Molecular Formula | C23H36N6O5S |
| Molecular Weight | 508.60 g/mol |
| Appearance | White to off-white crystalline powder |
| Melting Point | 188-189 °C |
| SMILES | CC1CNc2c(cccc2S(=O)(=O)N[C@@H](CCCN=C(N)N)C(=O)N2CC[C@@H](C)C[C@@H]2C(=O)O)C1 |
| InChIKey | KXNPVXPOPUZYGB-IOVMHBDKSA-N |
| Description | Argatroban, an arginine-derived direct thrombin inhibitor. Selectively binds the thrombin active site; used for heparin-induced thrombocytopenia treatment. |
| Applications | API; anticoagulant; thrombin inhibitor |
| Estimated Boiling Point | 777.2 °C (predicted) |
|---|---|
| Estimated Density | 1.47 g/cm³ (predicted) |