| Номер CAS | 74863-84-6 |
|---|---|
| Молекулярная формула | C23H36N6O5S |
| Молекулярная масса | 508.60 g/mol |
| Внешний вид | White to off-white crystalline powder |
| Температура плавления | 188-189 °C |
| SMILES | CC1CNc2c(cccc2S(=O)(=O)N[C@@H](CCCN=C(N)N)C(=O)N2CC[C@@H](C)C[C@@H]2C(=O)O)C1 |
| InChIKey | KXNPVXPOPUZYGB-IOVMHBDKSA-N |
| Описание | Argatroban, an arginine-derived direct thrombin inhibitor. Selectively binds the thrombin active site; used for heparin-induced thrombocytopenia treatment. |
| Применение | API; anticoagulant; thrombin inhibitor |
| Расчетная температура кипения | 777.2 °C (прогноз) |
|---|---|
| Расчетная плотность | 1.47 g/cm³ (прогноз) |