| Número CAS | 74863-84-6 |
|---|---|
| Fórmula molecular | C23H36N6O5S |
| Masa molar | 508.60 g/mol |
| Aspecto | White to off-white crystalline powder |
| Punto de fusión | 188-189 °C |
| SMILES | CC1CNc2c(cccc2S(=O)(=O)N[C@@H](CCCN=C(N)N)C(=O)N2CC[C@@H](C)C[C@@H]2C(=O)O)C1 |
| InChIKey | KXNPVXPOPUZYGB-IOVMHBDKSA-N |
| Descripción | Argatroban, an arginine-derived direct thrombin inhibitor. Selectively binds the thrombin active site; used for heparin-induced thrombocytopenia treatment. |
| Aplicaciones | API; anticoagulant; thrombin inhibitor |
| Punto de ebullición estimado | 777.2 °C (valor predicho) |
|---|---|
| Densidad estimada | 1.47 g/cm³ (valor predicho) |